C22H43N3O2 — CID 109449403
N-ethyl-4-(oxan-2-ylmethoxy)-N'-(2,2,4-trimethylpentyl)piperidine-1-carboximidamide (PubChem CID 109449403) has the molecular formula C22H43N3O2 and a molecular weight of 381.61 g/mol. Its IUPAC name is N-ethyl-4-(oxan-2-ylmethoxy)-N'-(2,2,4-trimethylpentyl)piperidine-1-carboximidamide.
| Compound Name | N-ethyl-4-(oxan-2-ylmethoxy)-N'-(2,2,4-trimethylpentyl)piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 109449403 |
| Molecular Formula | C22H43N3O2 |
| Molecular Weight | 381.61 g/mol |
| Exact Mass | 381.34 |
| IUPAC Name | N-ethyl-4-(oxan-2-ylmethoxy)-N'-(2,2,4-trimethylpentyl)piperidine-1-carboximidamide |
| SMILES | CCN/C(=N\CC(C)(C)CC(C)C)N1CCC(OCC2CCCCO2)CC1 |
| InChI | InChI=1S/C22H43N3O2/c1-6-23-21(24-17-22(4,5)15-18(2)3)25-12-10-19(11-13-25)27-16-20-9-7-8-14-26-20/h18-20H,6-17H2,1-5H3,(H,23,24) |
| InChIKey | PIZAZXSSQLAMLH-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 46.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.61 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|