C20H33N5OS — CID 110048030
2-[[(4-cyclohexylpiperazin-1-yl)-(thiophen-2-ylmethylamino)methylidene]amino]-N,N-dimethylacetamide (PubChem CID 110048030) has the molecular formula C20H33N5OS and a molecular weight of 391.59 g/mol. Its IUPAC name is 2-[[(4-cyclohexylpiperazin-1-yl)-(thiophen-2-ylmethylamino)methylidene]amino]-N,N-dimethylacetamide.
| Compound Name | 2-[[(4-cyclohexylpiperazin-1-yl)-(thiophen-2-ylmethylamino)methylidene]amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 110048030 |
| Molecular Formula | C20H33N5OS |
| Molecular Weight | 391.59 g/mol |
| Exact Mass | 391.24 |
| IUPAC Name | 2-[[(4-cyclohexylpiperazin-1-yl)-(thiophen-2-ylmethylamino)methylidene]amino]-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)C/N=C(\NCc1cccs1)N1CCN(C2CCCCC2)CC1 |
| InChI | InChI=1S/C20H33N5OS/c1-23(2)19(26)16-22-20(21-15-18-9-6-14-27-18)25-12-10-24(11-13-25)17-7-4-3-5-8-17/h6,9,14,17H,3-5,7-8,10-13,15-16H2,1-2H3,(H,21,22) |
| InChIKey | PKXXCXDMHMFYPB-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 51.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.59 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|