C20H33N5OS — CID 110042062
N,N-dimethyl-2-[[[3-(piperidin-1-ylmethyl)pyrrolidin-1-yl]-(thiophen-2-ylmethylamino)methylidene]amino]acetamide (PubChem CID 110042062) has the molecular formula C20H33N5OS and a molecular weight of 391.59 g/mol. Its IUPAC name is N,N-dimethyl-2-[[[3-(piperidin-1-ylmethyl)pyrrolidin-1-yl]-(thiophen-2-ylmethylamino)methylidene]amino]acetamide.
| Compound Name | N,N-dimethyl-2-[[[3-(piperidin-1-ylmethyl)pyrrolidin-1-yl]-(thiophen-2-ylmethylamino)methylidene]amino]acetamide |
|---|---|
| PubChem CID | 110042062 |
| Molecular Formula | C20H33N5OS |
| Molecular Weight | 391.59 g/mol |
| Exact Mass | 391.24 |
| IUPAC Name | N,N-dimethyl-2-[[[3-(piperidin-1-ylmethyl)pyrrolidin-1-yl]-(thiophen-2-ylmethylamino)methylidene]amino]acetamide |
| SMILES | CN(C)C(=O)C/N=C(\NCc1cccs1)N1CCC(CN2CCCCC2)C1 |
| InChI | InChI=1S/C20H33N5OS/c1-23(2)19(26)14-22-20(21-13-18-7-6-12-27-18)25-11-8-17(16-25)15-24-9-4-3-5-10-24/h6-7,12,17H,3-5,8-11,13-16H2,1-2H3,(H,21,22) |
| InChIKey | IZPKREUYZVFORD-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 51.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.59 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|