C17H29IN4OS — CID 110049443
2-[[(3,4-dimethylpiperidin-1-yl)-(thiophen-2-ylmethylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide (PubChem CID 110049443) has the molecular formula C17H29IN4OS and a molecular weight of 464.42 g/mol. Its IUPAC name is 2-[[(3,4-dimethylpiperidin-1-yl)-(thiophen-2-ylmethylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide.
| Compound Name | 2-[[(3,4-dimethylpiperidin-1-yl)-(thiophen-2-ylmethylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
|---|---|
| PubChem CID | 110049443 |
| Molecular Formula | C17H29IN4OS |
| Molecular Weight | 464.42 g/mol |
| Exact Mass | 464.11 |
| IUPAC Name | 2-[[(3,4-dimethylpiperidin-1-yl)-(thiophen-2-ylmethylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
| SMILES | CC1CCN(/C(=N/CC(=O)N(C)C)NCc2cccs2)CC1C.I |
| InChI | InChI=1S/C17H28N4OS.HI/c1-13-7-8-21(12-14(13)2)17(19-11-16(22)20(3)4)18-10-15-6-5-9-23-15;/h5-6,9,13-14H,7-8,10-12H2,1-4H3,(H,18,19);1H |
| InChIKey | IWEGMWJYFLEWRI-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 47.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.42 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|