C17H26N4OS — CID 110046950
2-[[6-azaspiro[3.4]octan-6-yl-(thiophen-2-ylmethylamino)methylidene]amino]-N,N-dimethylacetamide (PubChem CID 110046950) has the molecular formula C17H26N4OS and a molecular weight of 334.49 g/mol. Its IUPAC name is 2-[[6-azaspiro[3.4]octan-6-yl-(thiophen-2-ylmethylamino)methylidene]amino]-N,N-dimethylacetamide.
| Compound Name | 2-[[6-azaspiro[3.4]octan-6-yl-(thiophen-2-ylmethylamino)methylidene]amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 110046950 |
| Molecular Formula | C17H26N4OS |
| Molecular Weight | 334.49 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | 2-[[6-azaspiro[3.4]octan-6-yl-(thiophen-2-ylmethylamino)methylidene]amino]-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)C/N=C(\NCc1cccs1)N1CCC2(CCC2)C1 |
| InChI | InChI=1S/C17H26N4OS/c1-20(2)15(22)12-19-16(18-11-14-5-3-10-23-14)21-9-8-17(13-21)6-4-7-17/h3,5,10H,4,6-9,11-13H2,1-2H3,(H,18,19) |
| InChIKey | CWIRSOUAPGGNNE-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 47.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.49 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|