C22H35N5O3S — CID 110050192
tert-butyl N-[2-[N'-[2-(dimethylamino)-2-oxoethyl]-N-(thiophen-2-ylmethyl)carbamimidoyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]carbamate (PubChem CID 110050192) has the molecular formula C22H35N5O3S and a molecular weight of 449.62 g/mol. Its IUPAC name is tert-butyl N-[2-[N'-[2-(dimethylamino)-2-oxoethyl]-N-(thiophen-2-ylmethyl)carbamimidoyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]carbamate.
| Compound Name | tert-butyl N-[2-[N'-[2-(dimethylamino)-2-oxoethyl]-N-(thiophen-2-ylmethyl)carbamimidoyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]carbamate |
|---|---|
| PubChem CID | 110050192 |
| Molecular Formula | C22H35N5O3S |
| Molecular Weight | 449.62 g/mol |
| Exact Mass | 449.25 |
| IUPAC Name | tert-butyl N-[2-[N'-[2-(dimethylamino)-2-oxoethyl]-N-(thiophen-2-ylmethyl)carbamimidoyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]carbamate |
| SMILES | CN(C)C(=O)C/N=C(\NCc1cccs1)N1CC2CCC(NC(=O)OC(C)(C)C)C2C1 |
| InChI | InChI=1S/C22H35N5O3S/c1-22(2,3)30-21(29)25-18-9-8-15-13-27(14-17(15)18)20(24-12-19(28)26(4)5)23-11-16-7-6-10-31-16/h6-7,10,15,17-18H,8-9,11-14H2,1-5H3,(H,23,24)(H,25,29) |
| InChIKey | TZMDEPFYLPIERO-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 86.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.62 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|