C21H39N5O3 — CID 110050178
tert-butyl N-[2-[N-butyl-N'-[2-(dimethylamino)-2-oxoethyl]carbamimidoyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]carbamate (PubChem CID 110050178) has the molecular formula C21H39N5O3 and a molecular weight of 409.58 g/mol. Its IUPAC name is tert-butyl N-[2-[N-butyl-N'-[2-(dimethylamino)-2-oxoethyl]carbamimidoyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]carbamate.
| Compound Name | tert-butyl N-[2-[N-butyl-N'-[2-(dimethylamino)-2-oxoethyl]carbamimidoyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]carbamate |
|---|---|
| PubChem CID | 110050178 |
| Molecular Formula | C21H39N5O3 |
| Molecular Weight | 409.58 g/mol |
| Exact Mass | 409.31 |
| IUPAC Name | tert-butyl N-[2-[N-butyl-N'-[2-(dimethylamino)-2-oxoethyl]carbamimidoyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]carbamate |
| SMILES | CCCCN/C(=N\CC(=O)N(C)C)N1CC2CCC(NC(=O)OC(C)(C)C)C2C1 |
| InChI | InChI=1S/C21H39N5O3/c1-7-8-11-22-19(23-12-18(27)25(5)6)26-13-15-9-10-17(16(15)14-26)24-20(28)29-21(2,3)4/h15-17H,7-14H2,1-6H3,(H,22,23)(H,24,28) |
| InChIKey | ZHUOLHBIHVPTSM-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 86.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.58 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|