C20H33IN4O2 — CID 110038630
N,N-dimethyl-2-[[[3-(phenylmethoxymethyl)pyrrolidin-1-yl]-(propylamino)methylidene]amino]acetamide;hydroiodide (PubChem CID 110038630) has the molecular formula C20H33IN4O2 and a molecular weight of 488.41 g/mol. Its IUPAC name is N,N-dimethyl-2-[[[3-(phenylmethoxymethyl)pyrrolidin-1-yl]-(propylamino)methylidene]amino]acetamide;hydroiodide.
| Compound Name | N,N-dimethyl-2-[[[3-(phenylmethoxymethyl)pyrrolidin-1-yl]-(propylamino)methylidene]amino]acetamide;hydroiodide |
|---|---|
| PubChem CID | 110038630 |
| Molecular Formula | C20H33IN4O2 |
| Molecular Weight | 488.41 g/mol |
| Exact Mass | 488.16 |
| IUPAC Name | N,N-dimethyl-2-[[[3-(phenylmethoxymethyl)pyrrolidin-1-yl]-(propylamino)methylidene]amino]acetamide;hydroiodide |
| SMILES | CCCN/C(=N\CC(=O)N(C)C)N1CCC(COCc2ccccc2)C1.I |
| InChI | InChI=1S/C20H32N4O2.HI/c1-4-11-21-20(22-13-19(25)23(2)3)24-12-10-18(14-24)16-26-15-17-8-6-5-7-9-17;/h5-9,18H,4,10-16H2,1-3H3,(H,21,22);1H |
| InChIKey | UHEOZWDGSIOZRR-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 57.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.41 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|