C17H28N6O — CID 110037519
N,N-dimethyl-2-[[propylamino-(4-pyridin-2-ylpiperazin-1-yl)methylidene]amino]acetamide (PubChem CID 110037519) has the molecular formula C17H28N6O and a molecular weight of 332.45 g/mol. Its IUPAC name is N,N-dimethyl-2-[[propylamino-(4-pyridin-2-ylpiperazin-1-yl)methylidene]amino]acetamide.
| Compound Name | N,N-dimethyl-2-[[propylamino-(4-pyridin-2-ylpiperazin-1-yl)methylidene]amino]acetamide |
|---|---|
| PubChem CID | 110037519 |
| Molecular Formula | C17H28N6O |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.23 |
| IUPAC Name | N,N-dimethyl-2-[[propylamino-(4-pyridin-2-ylpiperazin-1-yl)methylidene]amino]acetamide |
| SMILES | CCCN/C(=N\CC(=O)N(C)C)N1CCN(c2ccccn2)CC1 |
| InChI | InChI=1S/C17H28N6O/c1-4-8-19-17(20-14-16(24)21(2)3)23-12-10-22(11-13-23)15-7-5-6-9-18-15/h5-7,9H,4,8,10-14H2,1-3H3,(H,19,20) |
| InChIKey | WPQNYQFEKYFMJO-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|