C17H28BrN7O2 — CID 110043193
2-[[[4-(5-bromo-4-methoxypyrimidin-2-yl)piperazin-1-yl]-(propylamino)methylidene]amino]-N,N-dimethylacetamide (PubChem CID 110043193) has the molecular formula C17H28BrN7O2 and a molecular weight of 442.36 g/mol. Its IUPAC name is 2-[[[4-(5-bromo-4-methoxypyrimidin-2-yl)piperazin-1-yl]-(propylamino)methylidene]amino]-N,N-dimethylacetamide.
| Compound Name | 2-[[[4-(5-bromo-4-methoxypyrimidin-2-yl)piperazin-1-yl]-(propylamino)methylidene]amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 110043193 |
| Molecular Formula | C17H28BrN7O2 |
| Molecular Weight | 442.36 g/mol |
| Exact Mass | 441.15 |
| IUPAC Name | 2-[[[4-(5-bromo-4-methoxypyrimidin-2-yl)piperazin-1-yl]-(propylamino)methylidene]amino]-N,N-dimethylacetamide |
| SMILES | CCCN/C(=N\CC(=O)N(C)C)N1CCN(c2ncc(Br)c(OC)n2)CC1 |
| InChI | InChI=1S/C17H28BrN7O2/c1-5-6-19-16(21-12-14(26)23(2)3)24-7-9-25(10-8-24)17-20-11-13(18)15(22-17)27-4/h11H,5-10,12H2,1-4H3,(H,19,21) |
| InChIKey | DYZXXUGKOATEQV-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 86.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.36 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|