C14H24BrIN6O2 — CID 109459675
4-(5-bromo-4-methoxypyrimidin-2-yl)-N-(2-methoxyethyl)-N'-methylpiperazine-1-carboximidamide;hydroiodide (PubChem CID 109459675) has the molecular formula C14H24BrIN6O2 and a molecular weight of 515.19 g/mol. Its IUPAC name is 4-(5-bromo-4-methoxypyrimidin-2-yl)-N-(2-methoxyethyl)-N'-methylpiperazine-1-carboximidamide;hydroiodide.
| Compound Name | 4-(5-bromo-4-methoxypyrimidin-2-yl)-N-(2-methoxyethyl)-N'-methylpiperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109459675 |
| Molecular Formula | C14H24BrIN6O2 |
| Molecular Weight | 515.19 g/mol |
| Exact Mass | 514.02 |
| IUPAC Name | 4-(5-bromo-4-methoxypyrimidin-2-yl)-N-(2-methoxyethyl)-N'-methylpiperazine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCCOC)N1CCN(c2ncc(Br)c(OC)n2)CC1.I |
| InChI | InChI=1S/C14H23BrN6O2.HI/c1-16-13(17-4-9-22-2)20-5-7-21(8-6-20)14-18-10-11(15)12(19-14)23-3;/h10H,4-9H2,1-3H3,(H,16,17);1H |
| InChIKey | ZKSKIOLNIOAPGB-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.19 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|