C12H19BrN6O — CID 109459862
4-(5-bromo-4-methoxypyrimidin-2-yl)-N,N'-dimethylpiperazine-1-carboximidamide (PubChem CID 109459862) has the molecular formula C12H19BrN6O and a molecular weight of 343.23 g/mol. Its IUPAC name is 4-(5-bromo-4-methoxypyrimidin-2-yl)-N,N'-dimethylpiperazine-1-carboximidamide.
| Compound Name | 4-(5-bromo-4-methoxypyrimidin-2-yl)-N,N'-dimethylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 109459862 |
| Molecular Formula | C12H19BrN6O |
| Molecular Weight | 343.23 g/mol |
| Exact Mass | 342.08 |
| IUPAC Name | 4-(5-bromo-4-methoxypyrimidin-2-yl)-N,N'-dimethylpiperazine-1-carboximidamide |
| SMILES | C/N=C(\NC)N1CCN(c2ncc(Br)c(OC)n2)CC1 |
| InChI | InChI=1S/C12H19BrN6O/c1-14-11(15-2)18-4-6-19(7-5-18)12-16-8-9(13)10(17-12)20-3/h8H,4-7H2,1-3H3,(H,14,15) |
| InChIKey | PHWUJOWSZGLTCH-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 65.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.23 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|