C16H25BrN6O2 — CID 109459808
4-(5-bromo-4-methoxypyrimidin-2-yl)-N'-methyl-N-[(3-methyloxetan-3-yl)methyl]piperazine-1-carboximidamide (PubChem CID 109459808) has the molecular formula C16H25BrN6O2 and a molecular weight of 413.32 g/mol. Its IUPAC name is 4-(5-bromo-4-methoxypyrimidin-2-yl)-N'-methyl-N-[(3-methyloxetan-3-yl)methyl]piperazine-1-carboximidamide.
| Compound Name | 4-(5-bromo-4-methoxypyrimidin-2-yl)-N'-methyl-N-[(3-methyloxetan-3-yl)methyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 109459808 |
| Molecular Formula | C16H25BrN6O2 |
| Molecular Weight | 413.32 g/mol |
| Exact Mass | 412.12 |
| IUPAC Name | 4-(5-bromo-4-methoxypyrimidin-2-yl)-N'-methyl-N-[(3-methyloxetan-3-yl)methyl]piperazine-1-carboximidamide |
| SMILES | C/N=C(\NCC1(C)COC1)N1CCN(c2ncc(Br)c(OC)n2)CC1 |
| InChI | InChI=1S/C16H25BrN6O2/c1-16(10-25-11-16)9-20-14(18-2)22-4-6-23(7-5-22)15-19-8-12(17)13(21-15)24-3/h8H,4-7,9-11H2,1-3H3,(H,18,20) |
| InChIKey | MCQRMYPMDGRFAP-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.32 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|