C18H32BrIN6O2 — CID 109459611
4-(5-bromo-4-methoxypyrimidin-2-yl)-N'-methyl-N-[3-(2-methylpropoxy)propyl]piperazine-1-carboximidamide;hydroiodide (PubChem CID 109459611) has the molecular formula C18H32BrIN6O2 and a molecular weight of 571.30 g/mol. Its IUPAC name is 4-(5-bromo-4-methoxypyrimidin-2-yl)-N'-methyl-N-[3-(2-methylpropoxy)propyl]piperazine-1-carboximidamide;hydroiodide.
| Compound Name | 4-(5-bromo-4-methoxypyrimidin-2-yl)-N'-methyl-N-[3-(2-methylpropoxy)propyl]piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109459611 |
| Molecular Formula | C18H32BrIN6O2 |
| Molecular Weight | 571.30 g/mol |
| Exact Mass | 570.08 |
| IUPAC Name | 4-(5-bromo-4-methoxypyrimidin-2-yl)-N'-methyl-N-[3-(2-methylpropoxy)propyl]piperazine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCCCOCC(C)C)N1CCN(c2ncc(Br)c(OC)n2)CC1.I |
| InChI | InChI=1S/C18H31BrN6O2.HI/c1-14(2)13-27-11-5-6-21-17(20-3)24-7-9-25(10-8-24)18-22-12-15(19)16(23-18)26-4;/h12,14H,5-11,13H2,1-4H3,(H,20,21);1H |
| InChIKey | DNNXMUYRCPSXNC-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.30 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|