C14H23BrN6O — CID 109459644
4-(5-bromo-4-methoxypyrimidin-2-yl)-N,N'-diethylpiperazine-1-carboximidamide (PubChem CID 109459644) has the molecular formula C14H23BrN6O and a molecular weight of 371.28 g/mol. Its IUPAC name is 4-(5-bromo-4-methoxypyrimidin-2-yl)-N,N'-diethylpiperazine-1-carboximidamide.
| Compound Name | 4-(5-bromo-4-methoxypyrimidin-2-yl)-N,N'-diethylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 109459644 |
| Molecular Formula | C14H23BrN6O |
| Molecular Weight | 371.28 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | 4-(5-bromo-4-methoxypyrimidin-2-yl)-N,N'-diethylpiperazine-1-carboximidamide |
| SMILES | CC/N=C(\NCC)N1CCN(c2ncc(Br)c(OC)n2)CC1 |
| InChI | InChI=1S/C14H23BrN6O/c1-4-16-13(17-5-2)20-6-8-21(9-7-20)14-18-10-11(15)12(19-14)22-3/h10H,4-9H2,1-3H3,(H,16,17) |
| InChIKey | VZVZBKKGRYPSFY-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 65.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.28 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|