C18H30BrN7O — CID 109459746
4-(5-bromo-4-methoxypyrimidin-2-yl)-N-ethyl-N'-[(1-methylpyrrolidin-3-yl)methyl]piperazine-1-carboximidamide (PubChem CID 109459746) has the molecular formula C18H30BrN7O and a molecular weight of 440.39 g/mol. Its IUPAC name is 4-(5-bromo-4-methoxypyrimidin-2-yl)-N-ethyl-N'-[(1-methylpyrrolidin-3-yl)methyl]piperazine-1-carboximidamide.
| Compound Name | 4-(5-bromo-4-methoxypyrimidin-2-yl)-N-ethyl-N'-[(1-methylpyrrolidin-3-yl)methyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 109459746 |
| Molecular Formula | C18H30BrN7O |
| Molecular Weight | 440.39 g/mol |
| Exact Mass | 439.17 |
| IUPAC Name | 4-(5-bromo-4-methoxypyrimidin-2-yl)-N-ethyl-N'-[(1-methylpyrrolidin-3-yl)methyl]piperazine-1-carboximidamide |
| SMILES | CCN/C(=N\CC1CCN(C)C1)N1CCN(c2ncc(Br)c(OC)n2)CC1 |
| InChI | InChI=1S/C18H30BrN7O/c1-4-20-17(21-11-14-5-6-24(2)13-14)25-7-9-26(10-8-25)18-22-12-15(19)16(23-18)27-3/h12,14H,4-11,13H2,1-3H3,(H,20,21) |
| InChIKey | UGWKZPVCCRFXCE-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 69.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.39 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|