C17H29BrN6OS — CID 109459686
4-(5-bromo-4-methoxypyrimidin-2-yl)-N-ethyl-N'-(2-methyl-2-methylsulfanylpropyl)piperazine-1-carboximidamide (PubChem CID 109459686) has the molecular formula C17H29BrN6OS and a molecular weight of 445.43 g/mol. Its IUPAC name is 4-(5-bromo-4-methoxypyrimidin-2-yl)-N-ethyl-N'-(2-methyl-2-methylsulfanylpropyl)piperazine-1-carboximidamide.
| Compound Name | 4-(5-bromo-4-methoxypyrimidin-2-yl)-N-ethyl-N'-(2-methyl-2-methylsulfanylpropyl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 109459686 |
| Molecular Formula | C17H29BrN6OS |
| Molecular Weight | 445.43 g/mol |
| Exact Mass | 444.13 |
| IUPAC Name | 4-(5-bromo-4-methoxypyrimidin-2-yl)-N-ethyl-N'-(2-methyl-2-methylsulfanylpropyl)piperazine-1-carboximidamide |
| SMILES | CCN/C(=N\CC(C)(C)SC)N1CCN(c2ncc(Br)c(OC)n2)CC1 |
| InChI | InChI=1S/C17H29BrN6OS/c1-6-19-15(21-12-17(2,3)26-5)23-7-9-24(10-8-23)16-20-11-13(18)14(22-16)25-4/h11H,6-10,12H2,1-5H3,(H,19,21) |
| InChIKey | DRPSMTCEZUFINQ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 65.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.43 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|