C16H28BrN7O — CID 109459734
4-(5-bromo-4-methoxypyrimidin-2-yl)-N-[2-[ethyl(methyl)amino]ethyl]-N'-methylpiperazine-1-carboximidamide (PubChem CID 109459734) has the molecular formula C16H28BrN7O and a molecular weight of 414.35 g/mol. Its IUPAC name is 4-(5-bromo-4-methoxypyrimidin-2-yl)-N-[2-[ethyl(methyl)amino]ethyl]-N'-methylpiperazine-1-carboximidamide.
| Compound Name | 4-(5-bromo-4-methoxypyrimidin-2-yl)-N-[2-[ethyl(methyl)amino]ethyl]-N'-methylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 109459734 |
| Molecular Formula | C16H28BrN7O |
| Molecular Weight | 414.35 g/mol |
| Exact Mass | 413.15 |
| IUPAC Name | 4-(5-bromo-4-methoxypyrimidin-2-yl)-N-[2-[ethyl(methyl)amino]ethyl]-N'-methylpiperazine-1-carboximidamide |
| SMILES | CCN(C)CCN/C(=N\C)N1CCN(c2ncc(Br)c(OC)n2)CC1 |
| InChI | InChI=1S/C16H28BrN7O/c1-5-22(3)7-6-19-15(18-2)23-8-10-24(11-9-23)16-20-12-13(17)14(21-16)25-4/h12H,5-11H2,1-4H3,(H,18,19) |
| InChIKey | HMLYGDKNCVIOKT-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 69.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.35 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|