C17H30BrIN6O2 — CID 109459483
4-(5-bromo-4-methoxypyrimidin-2-yl)-N-(2-butoxyethyl)-N'-methylpiperazine-1-carboximidamide;hydroiodide (PubChem CID 109459483) has the molecular formula C17H30BrIN6O2 and a molecular weight of 557.28 g/mol. Its IUPAC name is 4-(5-bromo-4-methoxypyrimidin-2-yl)-N-(2-butoxyethyl)-N'-methylpiperazine-1-carboximidamide;hydroiodide.
| Compound Name | 4-(5-bromo-4-methoxypyrimidin-2-yl)-N-(2-butoxyethyl)-N'-methylpiperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109459483 |
| Molecular Formula | C17H30BrIN6O2 |
| Molecular Weight | 557.28 g/mol |
| Exact Mass | 556.07 |
| IUPAC Name | 4-(5-bromo-4-methoxypyrimidin-2-yl)-N-(2-butoxyethyl)-N'-methylpiperazine-1-carboximidamide;hydroiodide |
| SMILES | CCCCOCCN/C(=N\C)N1CCN(c2ncc(Br)c(OC)n2)CC1.I |
| InChI | InChI=1S/C17H29BrN6O2.HI/c1-4-5-11-26-12-6-20-16(19-2)23-7-9-24(10-8-23)17-21-13-14(18)15(22-17)25-3;/h13H,4-12H2,1-3H3,(H,19,20);1H |
| InChIKey | BMLQUILITFCAFL-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.28 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|