C15H25BrN6O3S — CID 109459538
4-(5-bromo-4-methoxypyrimidin-2-yl)-N'-methyl-N-(3-methylsulfonylpropyl)piperazine-1-carboximidamide (PubChem CID 109459538) has the molecular formula C15H25BrN6O3S and a molecular weight of 449.38 g/mol. Its IUPAC name is 4-(5-bromo-4-methoxypyrimidin-2-yl)-N'-methyl-N-(3-methylsulfonylpropyl)piperazine-1-carboximidamide.
| Compound Name | 4-(5-bromo-4-methoxypyrimidin-2-yl)-N'-methyl-N-(3-methylsulfonylpropyl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 109459538 |
| Molecular Formula | C15H25BrN6O3S |
| Molecular Weight | 449.38 g/mol |
| Exact Mass | 448.09 |
| IUPAC Name | 4-(5-bromo-4-methoxypyrimidin-2-yl)-N'-methyl-N-(3-methylsulfonylpropyl)piperazine-1-carboximidamide |
| SMILES | C/N=C(\NCCCS(C)(=O)=O)N1CCN(c2ncc(Br)c(OC)n2)CC1 |
| InChI | InChI=1S/C15H25BrN6O3S/c1-17-14(18-5-4-10-26(3,23)24)21-6-8-22(9-7-21)15-19-11-12(16)13(20-15)25-2/h11H,4-10H2,1-3H3,(H,17,18) |
| InChIKey | YGRYZHZQDDBPOY-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 100.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.38 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|