C16H26BrIN6O3 — CID 109459705
methyl 3-[[[4-(5-bromo-4-methoxypyrimidin-2-yl)piperazin-1-yl]-(ethylamino)methylidene]amino]propanoate;hydroiodide (PubChem CID 109459705) has the molecular formula C16H26BrIN6O3 and a molecular weight of 557.23 g/mol. Its IUPAC name is methyl 3-[[[4-(5-bromo-4-methoxypyrimidin-2-yl)piperazin-1-yl]-(ethylamino)methylidene]amino]propanoate;hydroiodide.
| Compound Name | methyl 3-[[[4-(5-bromo-4-methoxypyrimidin-2-yl)piperazin-1-yl]-(ethylamino)methylidene]amino]propanoate;hydroiodide |
|---|---|
| PubChem CID | 109459705 |
| Molecular Formula | C16H26BrIN6O3 |
| Molecular Weight | 557.23 g/mol |
| Exact Mass | 556.03 |
| IUPAC Name | methyl 3-[[[4-(5-bromo-4-methoxypyrimidin-2-yl)piperazin-1-yl]-(ethylamino)methylidene]amino]propanoate;hydroiodide |
| SMILES | CCN/C(=N\CCC(=O)OC)N1CCN(c2ncc(Br)c(OC)n2)CC1.I |
| InChI | InChI=1S/C16H25BrN6O3.HI/c1-4-18-15(19-6-5-13(24)25-2)22-7-9-23(10-8-22)16-20-11-12(17)14(21-16)26-3;/h11H,4-10H2,1-3H3,(H,18,19);1H |
| InChIKey | QWWJELRAJNWJTH-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.23 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|