C17H27BrIN7O2 — CID 110043194
2-[[[4-(5-bromo-4-methoxypyrimidin-2-yl)piperazin-1-yl]-(prop-2-enylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide (PubChem CID 110043194) has the molecular formula C17H27BrIN7O2 and a molecular weight of 568.26 g/mol. Its IUPAC name is 2-[[[4-(5-bromo-4-methoxypyrimidin-2-yl)piperazin-1-yl]-(prop-2-enylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide.
| Compound Name | 2-[[[4-(5-bromo-4-methoxypyrimidin-2-yl)piperazin-1-yl]-(prop-2-enylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
|---|---|
| PubChem CID | 110043194 |
| Molecular Formula | C17H27BrIN7O2 |
| Molecular Weight | 568.26 g/mol |
| Exact Mass | 567.05 |
| IUPAC Name | 2-[[[4-(5-bromo-4-methoxypyrimidin-2-yl)piperazin-1-yl]-(prop-2-enylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
| SMILES | C=CCN/C(=N\CC(=O)N(C)C)N1CCN(c2ncc(Br)c(OC)n2)CC1.I |
| InChI | InChI=1S/C17H26BrN7O2.HI/c1-5-6-19-16(21-12-14(26)23(2)3)24-7-9-25(10-8-24)17-20-11-13(18)15(22-17)27-4;/h5,11H,1,6-10,12H2,2-4H3,(H,19,21);1H |
| InChIKey | FLFKAGBVVANQIM-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 86.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.26 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|