C17H28BrIN6O3 — CID 109459515
methyl 3-[[[4-(5-bromo-4-methoxypyrimidin-2-yl)piperazin-1-yl]-(ethylamino)methylidene]amino]-2-methylpropanoate;hydroiodide (PubChem CID 109459515) has the molecular formula C17H28BrIN6O3 and a molecular weight of 571.26 g/mol. Its IUPAC name is methyl 3-[[[4-(5-bromo-4-methoxypyrimidin-2-yl)piperazin-1-yl]-(ethylamino)methylidene]amino]-2-methylpropanoate;hydroiodide.
| Compound Name | methyl 3-[[[4-(5-bromo-4-methoxypyrimidin-2-yl)piperazin-1-yl]-(ethylamino)methylidene]amino]-2-methylpropanoate;hydroiodide |
|---|---|
| PubChem CID | 109459515 |
| Molecular Formula | C17H28BrIN6O3 |
| Molecular Weight | 571.26 g/mol |
| Exact Mass | 570.05 |
| IUPAC Name | methyl 3-[[[4-(5-bromo-4-methoxypyrimidin-2-yl)piperazin-1-yl]-(ethylamino)methylidene]amino]-2-methylpropanoate;hydroiodide |
| SMILES | CCN/C(=N\CC(C)C(=O)OC)N1CCN(c2ncc(Br)c(OC)n2)CC1.I |
| InChI | InChI=1S/C17H27BrN6O3.HI/c1-5-19-16(20-10-12(2)15(25)27-4)23-6-8-24(9-7-23)17-21-11-13(18)14(22-17)26-3;/h11-12H,5-10H2,1-4H3,(H,19,20);1H |
| InChIKey | REYZFSCUHGBMKL-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.26 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|