C16H26BrN7O2 — CID 109459580
2-[[[4-(5-bromo-4-methoxypyrimidin-2-yl)piperazin-1-yl]-(ethylamino)methylidene]amino]-N-ethylacetamide (PubChem CID 109459580) has the molecular formula C16H26BrN7O2 and a molecular weight of 428.34 g/mol. Its IUPAC name is 2-[[[4-(5-bromo-4-methoxypyrimidin-2-yl)piperazin-1-yl]-(ethylamino)methylidene]amino]-N-ethylacetamide.
| Compound Name | 2-[[[4-(5-bromo-4-methoxypyrimidin-2-yl)piperazin-1-yl]-(ethylamino)methylidene]amino]-N-ethylacetamide |
|---|---|
| PubChem CID | 109459580 |
| Molecular Formula | C16H26BrN7O2 |
| Molecular Weight | 428.34 g/mol |
| Exact Mass | 427.13 |
| IUPAC Name | 2-[[[4-(5-bromo-4-methoxypyrimidin-2-yl)piperazin-1-yl]-(ethylamino)methylidene]amino]-N-ethylacetamide |
| SMILES | CCNC(=O)C/N=C(\NCC)N1CCN(c2ncc(Br)c(OC)n2)CC1 |
| InChI | InChI=1S/C16H26BrN7O2/c1-4-18-13(25)11-21-15(19-5-2)23-6-8-24(9-7-23)16-20-10-12(17)14(22-16)26-3/h10H,4-9,11H2,1-3H3,(H,18,25)(H,19,21) |
| InChIKey | SLOAWYPHXZSFME-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 94.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.34 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|