C18H31IN6O — CID 110037524
2-[[(butan-2-ylamino)-(4-pyridin-2-ylpiperazin-1-yl)methylidene]amino]-N,N-dimethylacetamide;hydroiodide (PubChem CID 110037524) has the molecular formula C18H31IN6O and a molecular weight of 474.39 g/mol. Its IUPAC name is 2-[[(butan-2-ylamino)-(4-pyridin-2-ylpiperazin-1-yl)methylidene]amino]-N,N-dimethylacetamide;hydroiodide.
| Compound Name | 2-[[(butan-2-ylamino)-(4-pyridin-2-ylpiperazin-1-yl)methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
|---|---|
| PubChem CID | 110037524 |
| Molecular Formula | C18H31IN6O |
| Molecular Weight | 474.39 g/mol |
| Exact Mass | 474.16 |
| IUPAC Name | 2-[[(butan-2-ylamino)-(4-pyridin-2-ylpiperazin-1-yl)methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
| SMILES | CCC(C)N/C(=N\CC(=O)N(C)C)N1CCN(c2ccccn2)CC1.I |
| InChI | InChI=1S/C18H30N6O.HI/c1-5-15(2)21-18(20-14-17(25)22(3)4)24-12-10-23(11-13-24)16-8-6-7-9-19-16;/h6-9,15H,5,10-14H2,1-4H3,(H,20,21);1H |
| InChIKey | PFRBFDFCHYDAHY-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.39 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|