C22H36IN5O — CID 110037506
2-[[(butan-2-ylamino)-[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]methylidene]amino]-N,N-dimethylacetamide;hydroiodide (PubChem CID 110037506) has the molecular formula C22H36IN5O and a molecular weight of 513.47 g/mol. Its IUPAC name is 2-[[(butan-2-ylamino)-[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]methylidene]amino]-N,N-dimethylacetamide;hydroiodide.
| Compound Name | 2-[[(butan-2-ylamino)-[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
|---|---|
| PubChem CID | 110037506 |
| Molecular Formula | C22H36IN5O |
| Molecular Weight | 513.47 g/mol |
| Exact Mass | 513.20 |
| IUPAC Name | 2-[[(butan-2-ylamino)-[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
| SMILES | CCC(C)N/C(=N\CC(=O)N(C)C)N1CCN(C/C=C/c2ccccc2)CC1.I |
| InChI | InChI=1S/C22H35N5O.HI/c1-5-19(2)24-22(23-18-21(28)25(3)4)27-16-14-26(15-17-27)13-9-12-20-10-7-6-8-11-20;/h6-12,19H,5,13-18H2,1-4H3,(H,23,24);1H/b12-9+; |
| InChIKey | HVMYSQHNXRLTMJ-NBYYMMLRSA-N |
| XLogP | 2.77 |
| TPSA | 51.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.47 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|