C20H33N5O2 — CID 110038095
N,N-dimethyl-2-[[[4-(2-phenoxyethyl)piperazin-1-yl]-(propylamino)methylidene]amino]acetamide (PubChem CID 110038095) has the molecular formula C20H33N5O2 and a molecular weight of 375.52 g/mol. Its IUPAC name is N,N-dimethyl-2-[[[4-(2-phenoxyethyl)piperazin-1-yl]-(propylamino)methylidene]amino]acetamide.
| Compound Name | N,N-dimethyl-2-[[[4-(2-phenoxyethyl)piperazin-1-yl]-(propylamino)methylidene]amino]acetamide |
|---|---|
| PubChem CID | 110038095 |
| Molecular Formula | C20H33N5O2 |
| Molecular Weight | 375.52 g/mol |
| Exact Mass | 375.26 |
| IUPAC Name | N,N-dimethyl-2-[[[4-(2-phenoxyethyl)piperazin-1-yl]-(propylamino)methylidene]amino]acetamide |
| SMILES | CCCN/C(=N\CC(=O)N(C)C)N1CCN(CCOc2ccccc2)CC1 |
| InChI | InChI=1S/C20H33N5O2/c1-4-10-21-20(22-17-19(26)23(2)3)25-13-11-24(12-14-25)15-16-27-18-8-6-5-7-9-18/h5-9H,4,10-17H2,1-3H3,(H,21,22) |
| InChIKey | UXEDQOVGPAUEGZ-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 60.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.52 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|