C23H36IN5O3 — CID 110047275
2-[[(4-benzyl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-6-yl)-(oxolan-2-ylmethylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide (PubChem CID 110047275) has the molecular formula C23H36IN5O3 and a molecular weight of 557.48 g/mol. Its IUPAC name is 2-[[(4-benzyl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-6-yl)-(oxolan-2-ylmethylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide.
| Compound Name | 2-[[(4-benzyl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-6-yl)-(oxolan-2-ylmethylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
|---|---|
| PubChem CID | 110047275 |
| Molecular Formula | C23H36IN5O3 |
| Molecular Weight | 557.48 g/mol |
| Exact Mass | 557.19 |
| IUPAC Name | 2-[[(4-benzyl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-6-yl)-(oxolan-2-ylmethylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
| SMILES | CN(C)C(=O)C/N=C(\NCC1CCCO1)N1CC2OCCN(Cc3ccccc3)C2C1.I |
| InChI | InChI=1S/C23H35N5O3.HI/c1-26(2)22(29)14-25-23(24-13-19-9-6-11-30-19)28-16-20-21(17-28)31-12-10-27(20)15-18-7-4-3-5-8-18;/h3-5,7-8,19-21H,6,9-17H2,1-2H3,(H,24,25);1H |
| InChIKey | IZNNPAJBZFPFNY-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.48 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|