C20H33N5 — CID 110946940
N'-methyl-N-[3-(4-methyl-1,4-diazepan-1-yl)propyl]-3,4-dihydro-1H-isoquinoline-2-carboximidamide (PubChem CID 110946940) has the molecular formula C20H33N5 and a molecular weight of 343.52 g/mol. Its IUPAC name is N'-methyl-N-[3-(4-methyl-1,4-diazepan-1-yl)propyl]-3,4-dihydro-1H-isoquinoline-2-carboximidamide.
| Compound Name | N'-methyl-N-[3-(4-methyl-1,4-diazepan-1-yl)propyl]-3,4-dihydro-1H-isoquinoline-2-carboximidamide |
|---|---|
| PubChem CID | 110946940 |
| Molecular Formula | C20H33N5 |
| Molecular Weight | 343.52 g/mol |
| Exact Mass | 343.27 |
| IUPAC Name | N'-methyl-N-[3-(4-methyl-1,4-diazepan-1-yl)propyl]-3,4-dihydro-1H-isoquinoline-2-carboximidamide |
| SMILES | C/N=C(\NCCCN1CCCN(C)CC1)N1CCc2ccccc2C1 |
| InChI | InChI=1S/C20H33N5/c1-21-20(25-14-9-18-7-3-4-8-19(18)17-25)22-10-5-12-24-13-6-11-23(2)15-16-24/h3-4,7-8H,5-6,9-17H2,1-2H3,(H,21,22) |
| InChIKey | JYRVSAJJPKISHE-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 34.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.52 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|