C22H34N4O3 — CID 86939027
1-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-4-oxobutyl]-3-(4-morpholin-4-ylbutyl)urea (PubChem CID 86939027) has the molecular formula C22H34N4O3 and a molecular weight of 402.54 g/mol. Its IUPAC name is 1-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-4-oxobutyl]-3-(4-morpholin-4-ylbutyl)urea.
| Compound Name | 1-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-4-oxobutyl]-3-(4-morpholin-4-ylbutyl)urea |
|---|---|
| PubChem CID | 86939027 |
| Molecular Formula | C22H34N4O3 |
| Molecular Weight | 402.54 g/mol |
| Exact Mass | 402.26 |
| IUPAC Name | 1-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-4-oxobutyl]-3-(4-morpholin-4-ylbutyl)urea |
| SMILES | O=C(NCCCCN1CCOCC1)NCCCC(=O)N1CCc2ccccc2C1 |
| InChI | InChI=1S/C22H34N4O3/c27-21(26-13-9-19-6-1-2-7-20(19)18-26)8-5-11-24-22(28)23-10-3-4-12-25-14-16-29-17-15-25/h1-2,6-7H,3-5,8-18H2,(H2,23,24,28) |
| InChIKey | GJTZANVTJKZJQG-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.54 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|