C24H31N3O2S — CID 86939003
1-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-4-oxobutyl]-3-[2-[(4-methylphenyl)methylsulfanyl]ethyl]urea (PubChem CID 86939003) has the molecular formula C24H31N3O2S and a molecular weight of 425.60 g/mol. Its IUPAC name is 1-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-4-oxobutyl]-3-[2-[(4-methylphenyl)methylsulfanyl]ethyl]urea.
| Compound Name | 1-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-4-oxobutyl]-3-[2-[(4-methylphenyl)methylsulfanyl]ethyl]urea |
|---|---|
| PubChem CID | 86939003 |
| Molecular Formula | C24H31N3O2S |
| Molecular Weight | 425.60 g/mol |
| Exact Mass | 425.21 |
| IUPAC Name | 1-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-4-oxobutyl]-3-[2-[(4-methylphenyl)methylsulfanyl]ethyl]urea |
| SMILES | Cc1ccc(CSCCNC(=O)NCCCC(=O)N2CCc3ccccc3C2)cc1 |
| InChI | InChI=1S/C24H31N3O2S/c1-19-8-10-20(11-9-19)18-30-16-14-26-24(29)25-13-4-7-23(28)27-15-12-21-5-2-3-6-22(21)17-27/h2-3,5-6,8-11H,4,7,12-18H2,1H3,(H2,25,26,29) |
| InChIKey | OOKDPNLQRAXESO-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.60 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|