C26H36N8OS — CID 21383474
1-[(E)-N-(4,6-dimethylpyrimidin-2-yl)-N'-[(2-methylphenyl)carbamothioyl]carbamimidoyl]-4-piperidin-1-ylpiperidine-4-carboxamide (PubChem CID 21383474) has the molecular formula C26H36N8OS and a molecular weight of 508.70 g/mol. Its IUPAC name is 1-[(E)-N-(4,6-dimethylpyrimidin-2-yl)-N'-[(2-methylphenyl)carbamothioyl]carbamimidoyl]-4-piperidin-1-ylpiperidine-4-carboxamide.
| Compound Name | 1-[(E)-N-(4,6-dimethylpyrimidin-2-yl)-N'-[(2-methylphenyl)carbamothioyl]carbamimidoyl]-4-piperidin-1-ylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 21383474 |
| Molecular Formula | C26H36N8OS |
| Molecular Weight | 508.70 g/mol |
| Exact Mass | 508.27 |
| IUPAC Name | 1-[(E)-N-(4,6-dimethylpyrimidin-2-yl)-N'-[(2-methylphenyl)carbamothioyl]carbamimidoyl]-4-piperidin-1-ylpiperidine-4-carboxamide |
| SMILES | Cc1cc(C)nc(N/C(=N\C(=S)Nc2ccccc2C)N2CCC(C(N)=O)(N3CCCCC3)CC2)n1 |
| InChI | InChI=1S/C26H36N8OS/c1-18-9-5-6-10-21(18)30-25(36)32-24(31-23-28-19(2)17-20(3)29-23)33-15-11-26(12-16-33,22(27)35)34-13-7-4-8-14-34/h5-6,9-10,17H,4,7-8,11-16H2,1-3H3,(H2,27,35)(H2,28,29,30,31,32,36) |
| InChIKey | IUHZOVFUNDKUEO-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 111.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.70 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|