C22H24ClN7O3S — CID 17089811
1-(4-chlorophenyl)-3-[N-(4,6-dimethylpyrimidin-2-yl)-N'-[2-(4-sulfamoylphenyl)ethyl]carbamimidoyl]urea (PubChem CID 17089811) has the molecular formula C22H24ClN7O3S and a molecular weight of 502.00 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-[N-(4,6-dimethylpyrimidin-2-yl)-N'-[2-(4-sulfamoylphenyl)ethyl]carbamimidoyl]urea.
| Compound Name | 1-(4-chlorophenyl)-3-[N-(4,6-dimethylpyrimidin-2-yl)-N'-[2-(4-sulfamoylphenyl)ethyl]carbamimidoyl]urea |
|---|---|
| PubChem CID | 17089811 |
| Molecular Formula | C22H24ClN7O3S |
| Molecular Weight | 502.00 g/mol |
| Exact Mass | 501.13 |
| IUPAC Name | 1-(4-chlorophenyl)-3-[N-(4,6-dimethylpyrimidin-2-yl)-N'-[2-(4-sulfamoylphenyl)ethyl]carbamimidoyl]urea |
| SMILES | Cc1cc(C)nc(N/C(=N/CCc2ccc(S(N)(=O)=O)cc2)NC(=O)Nc2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C22H24ClN7O3S/c1-14-13-15(2)27-21(26-14)29-20(30-22(31)28-18-7-5-17(23)6-8-18)25-12-11-16-3-9-19(10-4-16)34(24,32)33/h3-10,13H,11-12H2,1-2H3,(H2,24,32,33)(H3,25,26,27,28,29,30,31) |
| InChIKey | XWOIMGXFTZCVMW-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 151.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.00 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|