C22H23FN6O — CID 17089446
1-[N-(4,6-dimethylpyrimidin-2-yl)-N'-[(4-fluorophenyl)methyl]carbamimidoyl]-3-(4-methylphenyl)urea (PubChem CID 17089446) has the molecular formula C22H23FN6O and a molecular weight of 406.47 g/mol. Its IUPAC name is 1-[N-(4,6-dimethylpyrimidin-2-yl)-N'-[(4-fluorophenyl)methyl]carbamimidoyl]-3-(4-methylphenyl)urea.
| Compound Name | 1-[N-(4,6-dimethylpyrimidin-2-yl)-N'-[(4-fluorophenyl)methyl]carbamimidoyl]-3-(4-methylphenyl)urea |
|---|---|
| PubChem CID | 17089446 |
| Molecular Formula | C22H23FN6O |
| Molecular Weight | 406.47 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | 1-[N-(4,6-dimethylpyrimidin-2-yl)-N'-[(4-fluorophenyl)methyl]carbamimidoyl]-3-(4-methylphenyl)urea |
| SMILES | Cc1ccc(NC(=O)N/C(=N\Cc2ccc(F)cc2)Nc2nc(C)cc(C)n2)cc1 |
| InChI | InChI=1S/C22H23FN6O/c1-14-4-10-19(11-5-14)27-22(30)29-20(24-13-17-6-8-18(23)9-7-17)28-21-25-15(2)12-16(3)26-21/h4-12H,13H2,1-3H3,(H3,24,25,26,27,28,29,30) |
| InChIKey | WTNSASHYPACRAZ-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 91.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.47 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|