C23H23ClN6O — CID 17078277
1-(4-chlorophenyl)-3-[N'-(2,3-dihydro-1H-inden-2-yl)-N-(4,6-dimethylpyrimidin-2-yl)carbamimidoyl]urea (PubChem CID 17078277) has the molecular formula C23H23ClN6O and a molecular weight of 434.93 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-[N'-(2,3-dihydro-1H-inden-2-yl)-N-(4,6-dimethylpyrimidin-2-yl)carbamimidoyl]urea.
| Compound Name | 1-(4-chlorophenyl)-3-[N'-(2,3-dihydro-1H-inden-2-yl)-N-(4,6-dimethylpyrimidin-2-yl)carbamimidoyl]urea |
|---|---|
| PubChem CID | 17078277 |
| Molecular Formula | C23H23ClN6O |
| Molecular Weight | 434.93 g/mol |
| Exact Mass | 434.16 |
| IUPAC Name | 1-(4-chlorophenyl)-3-[N'-(2,3-dihydro-1H-inden-2-yl)-N-(4,6-dimethylpyrimidin-2-yl)carbamimidoyl]urea |
| SMILES | Cc1cc(C)nc(N/C(=N\C2Cc3ccccc3C2)NC(=O)Nc2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C23H23ClN6O/c1-14-11-15(2)26-21(25-14)29-22(27-20-12-16-5-3-4-6-17(16)13-20)30-23(31)28-19-9-7-18(24)8-10-19/h3-11,20H,12-13H2,1-2H3,(H3,25,26,27,28,29,30,31) |
| InChIKey | JAXRHHZWNNIELF-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 91.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.93 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|