C11H18ClN5O — CID 126476570
N'-(4,6-dimethylpyrimidin-2-yl)morpholine-4-carboximidamide;hydrochloride (PubChem CID 126476570) has the molecular formula C11H18ClN5O and a molecular weight of 271.75 g/mol. Its IUPAC name is N'-(4,6-dimethylpyrimidin-2-yl)morpholine-4-carboximidamide;hydrochloride.
| Compound Name | N'-(4,6-dimethylpyrimidin-2-yl)morpholine-4-carboximidamide;hydrochloride |
|---|---|
| PubChem CID | 126476570 |
| Molecular Formula | C11H18ClN5O |
| Molecular Weight | 271.75 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | N'-(4,6-dimethylpyrimidin-2-yl)morpholine-4-carboximidamide;hydrochloride |
| SMILES | Cc1cc(C)nc(/N=C(\N)N2CCOCC2)n1.Cl |
| InChI | InChI=1S/C11H17N5O.ClH/c1-8-7-9(2)14-11(13-8)15-10(12)16-3-5-17-6-4-16;/h7H,3-6H2,1-2H3,(H2,12,13,14,15);1H |
| InChIKey | DGYXVYKQLGLOQQ-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 76.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.75 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|