C11H19N5O — CID 120913510
N'-[(2,5-dimethylpyrazol-3-yl)methyl]morpholine-4-carboximidamide (PubChem CID 120913510) has the molecular formula C11H19N5O and a molecular weight of 237.31 g/mol. Its IUPAC name is N'-[(2,5-dimethylpyrazol-3-yl)methyl]morpholine-4-carboximidamide.
| Compound Name | N'-[(2,5-dimethylpyrazol-3-yl)methyl]morpholine-4-carboximidamide |
|---|---|
| PubChem CID | 120913510 |
| Molecular Formula | C11H19N5O |
| Molecular Weight | 237.31 g/mol |
| Exact Mass | 237.16 |
| IUPAC Name | N'-[(2,5-dimethylpyrazol-3-yl)methyl]morpholine-4-carboximidamide |
| SMILES | Cc1cc(C/N=C(\N)N2CCOCC2)n(C)n1 |
| InChI | InChI=1S/C11H19N5O/c1-9-7-10(15(2)14-9)8-13-11(12)16-3-5-17-6-4-16/h7H,3-6,8H2,1-2H3,(H2,12,13) |
| InChIKey | VUYMLHQIJMVWNE-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 68.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.31 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|