C10H17IN4OS — CID 111100700
N'-[(4-methyl-1,3-thiazol-5-yl)methyl]morpholine-4-carboximidamide;hydroiodide (PubChem CID 111100700) has the molecular formula C10H17IN4OS and a molecular weight of 368.24 g/mol. Its IUPAC name is N'-[(4-methyl-1,3-thiazol-5-yl)methyl]morpholine-4-carboximidamide;hydroiodide.
| Compound Name | N'-[(4-methyl-1,3-thiazol-5-yl)methyl]morpholine-4-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111100700 |
| Molecular Formula | C10H17IN4OS |
| Molecular Weight | 368.24 g/mol |
| Exact Mass | 368.02 |
| IUPAC Name | N'-[(4-methyl-1,3-thiazol-5-yl)methyl]morpholine-4-carboximidamide;hydroiodide |
| SMILES | Cc1ncsc1C/N=C(\N)N1CCOCC1.I |
| InChI | InChI=1S/C10H16N4OS.HI/c1-8-9(16-7-13-8)6-12-10(11)14-2-4-15-5-3-14;/h7H,2-6H2,1H3,(H2,11,12);1H |
| InChIKey | QPDTZPDDPMAFGG-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 63.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.24 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|