C10H19IN4S — CID 110935746
1-(2-methylpropyl)-2-[(4-methyl-1,3-thiazol-5-yl)methyl]guanidine;hydroiodide (PubChem CID 110935746) has the molecular formula C10H19IN4S and a molecular weight of 354.26 g/mol. Its IUPAC name is 1-(2-methylpropyl)-2-[(4-methyl-1,3-thiazol-5-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-(2-methylpropyl)-2-[(4-methyl-1,3-thiazol-5-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 110935746 |
| Molecular Formula | C10H19IN4S |
| Molecular Weight | 354.26 g/mol |
| Exact Mass | 354.04 |
| IUPAC Name | 1-(2-methylpropyl)-2-[(4-methyl-1,3-thiazol-5-yl)methyl]guanidine;hydroiodide |
| SMILES | Cc1ncsc1C/N=C(\N)NCC(C)C.I |
| InChI | InChI=1S/C10H18N4S.HI/c1-7(2)4-12-10(11)13-5-9-8(3)14-6-15-9;/h6-7H,4-5H2,1-3H3,(H3,11,12,13);1H |
| InChIKey | PWFHAXCKNCQGKG-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 63.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.26 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|