C10H18N4O — CID 106373219
2-[(5-methyl-1,3-oxazol-2-yl)methyl]-1-(2-methylpropyl)guanidine (PubChem CID 106373219) has the molecular formula C10H18N4O and a molecular weight of 210.28 g/mol. Its IUPAC name is 2-[(5-methyl-1,3-oxazol-2-yl)methyl]-1-(2-methylpropyl)guanidine.
| Compound Name | 2-[(5-methyl-1,3-oxazol-2-yl)methyl]-1-(2-methylpropyl)guanidine |
|---|---|
| PubChem CID | 106373219 |
| Molecular Formula | C10H18N4O |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.15 |
| IUPAC Name | 2-[(5-methyl-1,3-oxazol-2-yl)methyl]-1-(2-methylpropyl)guanidine |
| SMILES | Cc1cnc(C/N=C(\N)NCC(C)C)o1 |
| InChI | InChI=1S/C10H18N4O/c1-7(2)4-13-10(11)14-6-9-12-5-8(3)15-9/h5,7H,4,6H2,1-3H3,(H3,11,13,14) |
| InChIKey | ZAQBDGHVJNTYAR-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 76.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|