C9H16N4O — CID 79492896
1-(2-methylpropyl)-2-(1,2-oxazol-3-ylmethyl)guanidine (PubChem CID 79492896) has the molecular formula C9H16N4O and a molecular weight of 196.25 g/mol. Its IUPAC name is 1-(2-methylpropyl)-2-(1,2-oxazol-3-ylmethyl)guanidine.
| Compound Name | 1-(2-methylpropyl)-2-(1,2-oxazol-3-ylmethyl)guanidine |
|---|---|
| PubChem CID | 79492896 |
| Molecular Formula | C9H16N4O |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.13 |
| IUPAC Name | 1-(2-methylpropyl)-2-(1,2-oxazol-3-ylmethyl)guanidine |
| SMILES | CC(C)CN/C(N)=N/Cc1ccon1 |
| InChI | InChI=1S/C9H16N4O/c1-7(2)5-11-9(10)12-6-8-3-4-14-13-8/h3-4,7H,5-6H2,1-2H3,(H3,10,11,12) |
| InChIKey | ZHFSLONXMUXBHC-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 76.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|