C11H21IN4S — CID 111806939
2-[(2-ethyl-1,3-thiazol-4-yl)methyl]-1-(2-methylpropyl)guanidine;hydroiodide (PubChem CID 111806939) has the molecular formula C11H21IN4S and a molecular weight of 368.29 g/mol. Its IUPAC name is 2-[(2-ethyl-1,3-thiazol-4-yl)methyl]-1-(2-methylpropyl)guanidine;hydroiodide.
| Compound Name | 2-[(2-ethyl-1,3-thiazol-4-yl)methyl]-1-(2-methylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111806939 |
| Molecular Formula | C11H21IN4S |
| Molecular Weight | 368.29 g/mol |
| Exact Mass | 368.05 |
| IUPAC Name | 2-[(2-ethyl-1,3-thiazol-4-yl)methyl]-1-(2-methylpropyl)guanidine;hydroiodide |
| SMILES | CCc1nc(C/N=C(\N)NCC(C)C)cs1.I |
| InChI | InChI=1S/C11H20N4S.HI/c1-4-10-15-9(7-16-10)6-14-11(12)13-5-8(2)3;/h7-8H,4-6H2,1-3H3,(H3,12,13,14);1H |
| InChIKey | JYAWIAVJDWIJMT-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 63.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.29 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|