C14H27IN4O — CID 111814007
2-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-1-(3-methylbutyl)guanidine;hydroiodide (PubChem CID 111814007) has the molecular formula C14H27IN4O and a molecular weight of 394.30 g/mol. Its IUPAC name is 2-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-1-(3-methylbutyl)guanidine;hydroiodide.
| Compound Name | 2-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-1-(3-methylbutyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111814007 |
| Molecular Formula | C14H27IN4O |
| Molecular Weight | 394.30 g/mol |
| Exact Mass | 394.12 |
| IUPAC Name | 2-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-1-(3-methylbutyl)guanidine;hydroiodide |
| SMILES | CC(C)CCN/C(N)=N/Cc1ncc(C(C)(C)C)o1.I |
| InChI | InChI=1S/C14H26N4O.HI/c1-10(2)6-7-16-13(15)18-9-12-17-8-11(19-12)14(3,4)5;/h8,10H,6-7,9H2,1-5H3,(H3,15,16,18);1H |
| InChIKey | QNJSBSXKDQTYDA-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 76.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.30 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|