C11H16Br2N4 — CID 122097065
2-[(3,5-dibromo-4-pyridinyl)methyl]-1-(2-methylpropyl)guanidine (PubChem CID 122097065) has the molecular formula C11H16Br2N4 and a molecular weight of 364.09 g/mol. Its IUPAC name is 2-[(3,5-dibromo-4-pyridinyl)methyl]-1-(2-methylpropyl)guanidine.
| Compound Name | 2-[(3,5-dibromo-4-pyridinyl)methyl]-1-(2-methylpropyl)guanidine |
|---|---|
| PubChem CID | 122097065 |
| Molecular Formula | C11H16Br2N4 |
| Molecular Weight | 364.09 g/mol |
| Exact Mass | 361.97 |
| IUPAC Name | 2-[(3,5-dibromo-4-pyridinyl)methyl]-1-(2-methylpropyl)guanidine |
| SMILES | CC(C)CN/C(N)=N/Cc1c(Br)cncc1Br |
| InChI | InChI=1S/C11H16Br2N4/c1-7(2)3-16-11(14)17-4-8-9(12)5-15-6-10(8)13/h5-7H,3-4H2,1-2H3,(H3,14,16,17) |
| InChIKey | SCUKIJXGCWRNCL-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 63.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.09 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|