C8H17N7 — CID 120603258
1-(2-methylpropyl)-2-[(2-methyltetrazol-5-yl)methyl]guanidine (PubChem CID 120603258) has the molecular formula C8H17N7 and a molecular weight of 211.27 g/mol. Its IUPAC name is 1-(2-methylpropyl)-2-[(2-methyltetrazol-5-yl)methyl]guanidine.
| Compound Name | 1-(2-methylpropyl)-2-[(2-methyltetrazol-5-yl)methyl]guanidine |
|---|---|
| PubChem CID | 120603258 |
| Molecular Formula | C8H17N7 |
| Molecular Weight | 211.27 g/mol |
| Exact Mass | 211.15 |
| IUPAC Name | 1-(2-methylpropyl)-2-[(2-methyltetrazol-5-yl)methyl]guanidine |
| SMILES | CC(C)CN/C(N)=N/Cc1nnn(C)n1 |
| InChI | InChI=1S/C8H17N7/c1-6(2)4-10-8(9)11-5-7-12-14-15(3)13-7/h6H,4-5H2,1-3H3,(H3,9,10,11) |
| InChIKey | WHNSPAGNRYOREF-UHFFFAOYSA-N |
| XLogP | -0.73 |
| TPSA | 94.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.27 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|