C10H20N6O — CID 107042666
N-(2-methylpropyl)-3-[(2-methyltetrazol-5-yl)methylamino]propanamide (PubChem CID 107042666) has the molecular formula C10H20N6O and a molecular weight of 240.31 g/mol. Its IUPAC name is N-(2-methylpropyl)-3-[(2-methyltetrazol-5-yl)methylamino]propanamide.
| Compound Name | N-(2-methylpropyl)-3-[(2-methyltetrazol-5-yl)methylamino]propanamide |
|---|---|
| PubChem CID | 107042666 |
| Molecular Formula | C10H20N6O |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.17 |
| IUPAC Name | N-(2-methylpropyl)-3-[(2-methyltetrazol-5-yl)methylamino]propanamide |
| SMILES | CC(C)CNC(=O)CCNCc1nnn(C)n1 |
| InChI | InChI=1S/C10H20N6O/c1-8(2)6-12-10(17)4-5-11-7-9-13-15-16(3)14-9/h8,11H,4-7H2,1-3H3,(H,12,17) |
| InChIKey | QFMCAPHLXSCSNT-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|