C12H25N3OS — CID 116510044
N-(2-methylpropyl)-3-(2-methylpropylcarbamothioylamino)propanamide (PubChem CID 116510044) has the molecular formula C12H25N3OS and a molecular weight of 259.42 g/mol. Its IUPAC name is N-(2-methylpropyl)-3-(2-methylpropylcarbamothioylamino)propanamide.
| Compound Name | N-(2-methylpropyl)-3-(2-methylpropylcarbamothioylamino)propanamide |
|---|---|
| PubChem CID | 116510044 |
| Molecular Formula | C12H25N3OS |
| Molecular Weight | 259.42 g/mol |
| Exact Mass | 259.17 |
| IUPAC Name | N-(2-methylpropyl)-3-(2-methylpropylcarbamothioylamino)propanamide |
| SMILES | CC(C)CNC(=O)CCNC(=S)NCC(C)C |
| InChI | InChI=1S/C12H25N3OS/c1-9(2)7-14-11(16)5-6-13-12(17)15-8-10(3)4/h9-10H,5-8H2,1-4H3,(H,14,16)(H2,13,15,17) |
| InChIKey | MLQKVENWJWCOPI-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.42 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|