C8H17N3OS — CID 115571220
N-methyl-2-(2-methylpropylcarbamothioylamino)acetamide (PubChem CID 115571220) has the molecular formula C8H17N3OS and a molecular weight of 203.31 g/mol. Its IUPAC name is N-methyl-2-(2-methylpropylcarbamothioylamino)acetamide.
| Compound Name | N-methyl-2-(2-methylpropylcarbamothioylamino)acetamide |
|---|---|
| PubChem CID | 115571220 |
| Molecular Formula | C8H17N3OS |
| Molecular Weight | 203.31 g/mol |
| Exact Mass | 203.11 |
| IUPAC Name | N-methyl-2-(2-methylpropylcarbamothioylamino)acetamide |
| SMILES | CNC(=O)CNC(=S)NCC(C)C |
| InChI | InChI=1S/C8H17N3OS/c1-6(2)4-10-8(13)11-5-7(12)9-3/h6H,4-5H2,1-3H3,(H,9,12)(H2,10,11,13) |
| InChIKey | XEDAZIHHQFLXCO-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.31 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|