C11H23N3OS — CID 103822773
N,2,2-trimethyl-3-(2-methylpropylcarbamothioylamino)propanamide (PubChem CID 103822773) has the molecular formula C11H23N3OS and a molecular weight of 245.39 g/mol. Its IUPAC name is N,2,2-trimethyl-3-(2-methylpropylcarbamothioylamino)propanamide.
| Compound Name | N,2,2-trimethyl-3-(2-methylpropylcarbamothioylamino)propanamide |
|---|---|
| PubChem CID | 103822773 |
| Molecular Formula | C11H23N3OS |
| Molecular Weight | 245.39 g/mol |
| Exact Mass | 245.16 |
| IUPAC Name | N,2,2-trimethyl-3-(2-methylpropylcarbamothioylamino)propanamide |
| SMILES | CNC(=O)C(C)(C)CNC(=S)NCC(C)C |
| InChI | InChI=1S/C11H23N3OS/c1-8(2)6-13-10(16)14-7-11(3,4)9(15)12-5/h8H,6-7H2,1-5H3,(H,12,15)(H2,13,14,16) |
| InChIKey | FMWYLVLCPYIDNA-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.39 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|