C10H18ClN3O3 — CID 106279493
3-(2-chloropropanoylcarbamoylamino)-N,2,2-trimethylpropanamide (PubChem CID 106279493) has the molecular formula C10H18ClN3O3 and a molecular weight of 263.72 g/mol. Its IUPAC name is 3-(2-chloropropanoylcarbamoylamino)-N,2,2-trimethylpropanamide.
| Compound Name | 3-(2-chloropropanoylcarbamoylamino)-N,2,2-trimethylpropanamide |
|---|---|
| PubChem CID | 106279493 |
| Molecular Formula | C10H18ClN3O3 |
| Molecular Weight | 263.72 g/mol |
| Exact Mass | 263.10 |
| IUPAC Name | 3-(2-chloropropanoylcarbamoylamino)-N,2,2-trimethylpropanamide |
| SMILES | CNC(=O)C(C)(C)CNC(=O)NC(=O)C(C)Cl |
| InChI | InChI=1S/C10H18ClN3O3/c1-6(11)7(15)14-9(17)13-5-10(2,3)8(16)12-4/h6H,5H2,1-4H3,(H,12,16)(H2,13,14,15,17) |
| InChIKey | RMWYEVIIGVTMMP-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.72 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|